Difference between revisions of "Demethylated-Ubiquinols"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] == * smiles: ** CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Demethylated-Ubiquinols Demethylated-Ubiquinols] == * common name: ** a demethylated ubiquinol...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Demethylated-Ubiquinols Demethylated-Ubiquinols] ==
* smiles:
+
** CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J
+
 
* common name:
 
* common name:
** (S)-3-hydroxy-(9Z)-hexadecenoyl-CoA
+
** a demethylated ubiquinol
* molecular weight:
+
** 1015.898   
+
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-16:1-Δ9-CoA
 
** (S)-3-hydroxy-9-cis-hexadecenoyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17790]]
+
* [[RXN-11758]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17789]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=a demethylated ubiquinol}}
{{#set: inchi key=InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J}}
+
{{#set: consumed by=RXN-11758}}
{{#set: common name=(S)-3-hydroxy-(9Z)-hexadecenoyl-CoA}}
+
{{#set: molecular weight=1015.898    }}
+
{{#set: common name=(S)-3-hydroxy-16:1-Δ9-CoA|(S)-3-hydroxy-9-cis-hexadecenoyl-CoA}}
+
{{#set: consumed by=RXN-17790}}
+
{{#set: produced by=RXN-17789}}
+

Latest revision as of 16:46, 23 May 2018

Metabolite Demethylated-Ubiquinols

  • common name:
    • a demethylated ubiquinol
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links