Difference between revisions of "RXN-17728"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18494 CPD-18494] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17728 RXN-17728] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl/alkyl-DHAP reductase *...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18494 CPD-18494] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17728 RXN-17728] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=UIAGUJIMVQPSDP-QOJZHLSOSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
+
** acyl/alkyl-DHAP reductase
−
* molecular weight:
+
* ec number:
−
** 1118.034   
+
** [http://enzyme.expasy.org/EC/1.1.1.101 EC-1.1.1.101]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17116]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[1-ALKYL-GLYCERONE-3-PHOSPHATE]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[1-Alkyl-glycerol-3-phosphate]][c] '''+''' 1 [[NADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a 1-alkyl-glycerone 3-phosphate[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 a 1-alkyl-sn-glycerol 3-phosphate[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00004694001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00000399001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00008374001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways  ==
 +
* [[PWY-7782]], plasmalogen biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7782 PWY-7782]
 +
** '''6''' reactions found over '''16''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193740 72193740]
+
{{#set: common name=acyl/alkyl-DHAP reductase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.1.1.101}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76367 76367]
+
{{#set: gene associated=CHC_T00004694001_1|CHC_T00000399001_1|CHC_T00008374001_1}}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: in pathway=PWY-7782}}
−
{{#set: inchi key=InChIKey=UIAGUJIMVQPSDP-QOJZHLSOSA-J}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}}
+
{{#set: reconstruction source=orthology-arabidopsis_thaliana}}
−
{{#set: molecular weight=1118.034    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-17116}}
+

Latest revision as of 16:48, 23 May 2018

Reaction RXN-17728

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl/alkyl-DHAP reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7782, plasmalogen biosynthesis: PWY-7782
    • 6 reactions found over 16 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-17728&oldid=18148"