Difference between revisions of "RXN0-2141"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11528 CPD-11528] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2141 RXN0-2141] == * direction: ** LEFT-TO-RIGHT * common name: ** Beta-ketoacyl synthase * ec...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11528 CPD-11528] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2141 RXN0-2141] ==
−
* smiles:
+
* direction:
−
** CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QGJLCXXJEFRWHP-BUMUVWNNSA-J
+
 
* common name:
 
* common name:
−
** OPC4-3-ketoacyl-CoA
+
** Beta-ketoacyl synthase
−
* molecular weight:
+
* ec number:
−
** 997.797   
+
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10701]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[Cis-delta-3-decenoyl-ACPs]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[b-Keto-cis-D5-dodecenoyl-ACPs]][c]
−
* [[RXN-10703]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 a malonyl-[acp][c] '''+''' 1 a (3Z)-dec-3-enoyl-[acp][c] '''=>''' 1 CO2[c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 a (5Z)-3-oxo-dodec-5-enoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009465001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00009465001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY0-862]], (5Z)-dodec-5-enoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-862 PWY0-862]
 +
** '''4''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237346 44237346]
+
{{#set: common name=Beta-ketoacyl synthase}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
{{#set: ec number=EC-2.3.1.41}}
−
{{#set: inchi key=InChIKey=QGJLCXXJEFRWHP-BUMUVWNNSA-J}}
+
{{#set: gene associated=CHC_T00009465001_1|CHC_T00009465001}}
−
{{#set: common name=OPC4-3-ketoacyl-CoA}}
+
{{#set: in pathway=PWY0-862}}
−
{{#set: molecular weight=997.797    }}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: consumed by=RXN-10701}}
+
{{#set: reconstruction source=annotation-original_genome|orthology-ectocarpus_siliculosus}}
−
{{#set: produced by=RXN-10703}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 16:49, 23 May 2018

Reaction RXN0-2141

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Beta-ketoacyl synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-862, (5Z)-dodec-5-enoate biosynthesis: PWY0-862
    • 4 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN0-2141&oldid=18196"