Difference between revisions of "CHC T00009359001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TDP TDP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])[O-])O2)) * in...") |
(Created page with "Category:Gene == Gene CHC_T00009359001 == * left end position: ** 223513 * transcription direction: ** POSITIVE * right end position: ** 230916 * centisome position: ** 21...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009359001 == |
− | * | + | * left end position: |
− | ** | + | ** 223513 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 230916 |
− | * | + | * centisome position: |
− | ** | + | ** 21.793518 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[ACETYL-COA-CARBOXYLTRANSFER-RXN]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | == | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[RXN0-5055]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | + | *** Assignment: automated-name-match | |
+ | == Pathways associated == | ||
+ | * [[PWY0-1264]] | ||
+ | * [[PWY-7388]] | ||
+ | * [[PWY-6722]] | ||
+ | * [[PWY-5743]] | ||
+ | * [[PWY-5744]] | ||
+ | * [[PWY-5789]] | ||
+ | * [[PWY-6679]] | ||
+ | * [[PWY-4381]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=223513}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=230916}} | |
− | + | {{#set: centisome position=21.793518 }} | |
− | + | {{#set: reaction associated=ACETYL-COA-CARBOXYLTRANSFER-RXN|RXN0-5055}} | |
− | + | {{#set: pathway associated=PWY0-1264|PWY-7388|PWY-6722|PWY-5743|PWY-5744|PWY-5789|PWY-6679|PWY-4381}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:49, 23 May 2018
Gene CHC_T00009359001
- left end position:
- 223513
- transcription direction:
- POSITIVE
- right end position:
- 230916
- centisome position:
- 21.793518
- Synonym(s):
Reactions associated
- Reaction: ACETYL-COA-CARBOXYLTRANSFER-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN0-5055
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome