Difference between revisions of "NUCLEOSIDE-TRIPHOSPHATASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7224 CPD-7224] == * smiles: ** CC(=O)NC(C([O-])=O)CCCNC(=O)N * inchi key: ** InChIKey=WMQMI...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6894 PWY-6894] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7224 CPD-7224] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6894 PWY-6894] ==
−
* smiles:
+
* taxonomic range:
−
** CC(=O)NC(C([O-])=O)CCCNC(=O)N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=WMQMIOYQXNRROC-LURJTMIESA-M
+
 
* common name:
 
* common name:
−
** N-acetyl-L-citrulline
+
** thiamine diphosphate biosynthesis I (E. coli)
−
* molecular weight:
+
−
** 216.216   
+
 
* Synonym(s):
 
* Synonym(s):
−
** acetyl-citrulline
+
** vitamin B1 biosynthesis
−
** N5-acetylcarbamoyl-L-ornithine
+
** thiamin diphosphate biosynthesis I (E. coli)
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-7933]]
+
* '''1''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[RXN-12611]]
−
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''1''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=THI-P-KIN-RXN THI-P-KIN-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266759 45266759]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6894 PWY-6894]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58765 58765]
+
{{#set: common name=thiamine diphosphate biosynthesis I (E. coli)}}
−
* LIGAND-CPD:
+
{{#set: common name=vitamin B1 biosynthesis|thiamin diphosphate biosynthesis I (E. coli)}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15532 C15532]
+
{{#set: reaction found=1}}
−
* HMDB : HMDB00856
+
{{#set: reaction not found=1}}
−
{{#set: smiles=CC(=O)NC(C([O-])=O)CCCNC(=O)N}}
+
−
{{#set: inchi key=InChIKey=WMQMIOYQXNRROC-LURJTMIESA-M}}
+
−
{{#set: common name=N-acetyl-L-citrulline}}
+
−
{{#set: molecular weight=216.216    }}
+
−
{{#set: common name=acetyl-citrulline|N5-acetylcarbamoyl-L-ornithine}}
+
−
{{#set: consumed by=RXN-7933}}
+

Revision as of 10:55, 18 January 2018

Pathway PWY-6894

  • taxonomic range:
  • common name:
    • thiamine diphosphate biosynthesis I (E. coli)
  • Synonym(s):
    • vitamin B1 biosynthesis
    • thiamin diphosphate biosynthesis I (E. coli)

Reaction(s) found

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=NUCLEOSIDE-TRIPHOSPHATASE-RXN&oldid=5461"