Difference between revisions of "BIO-5-AMP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008451001 == * left end position: ** 94521 * transcription direction: ** POSITIVE * right end position: ** 95897 * centisome position: ** 37.4...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008451001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] ==
* left end position:
+
* smiles:
** 94521
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M
* right end position:
+
* common name:
** 95897
+
** biotinyl-5'-adenylate
* centisome position:
+
* molecular weight:
** 37.404728    
+
** 572.509    
 
* Synonym(s):
 
* Synonym(s):
 +
** biotinyl-5'-AMP
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[HISTALDEHYD-RXN]]
+
== Reaction(s) known to produce the compound ==
** original_genome
+
* [[RXN0-7192]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
* [[HISTOLDEHYD-RXN]]
+
** original_genome
+
***automated-name-match
+
* [[RXN-8001]]
+
** original_genome
+
***automated-name-match
+
== Pathways associated ==
+
* [[HISTSYN-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=94521}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53239798 53239798]
{{#set: right end position=95897}}
+
* CHEBI:
{{#set: centisome position=37.404728   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62414 62414]
{{#set: reaction associated=HISTALDEHYD-RXN|HISTOLDEHYD-RXN|RXN-8001}}
+
* LIGAND-CPD:
{{#set: pathway associated=HISTSYN-PWY}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05921 C05921]
 +
* HMDB : HMDB04220
 +
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))}}
 +
{{#set: inchi key=InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M}}
 +
{{#set: common name=biotinyl-5'-adenylate}}
 +
{{#set: molecular weight=572.509   }}
 +
{{#set: common name=biotinyl-5'-AMP}}
 +
{{#set: produced by=RXN0-7192}}

Revision as of 16:51, 23 May 2018

Metabolite BIO-5-AMP

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))
  • inchi key:
    • InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M
  • common name:
    • biotinyl-5'-adenylate
  • molecular weight:
    • 572.509
  • Synonym(s):
    • biotinyl-5'-AMP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))" cannot be used as a page name in this wiki.