Difference between revisions of "RXN-17897"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17897 RXN-17897] == * direction: ** LEFT-TO-RIGHT * common name: ** Ferredoxin-NADP+ oxidoreduc...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17897 RXN-17897] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Ferredoxin-NADP+ oxidoreductase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.18.1.2 EC-1.18.1.2] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[NADPH]][c] '''+''' 2 [[Oxidized-ferredoxins]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 NADPH[c] '''+''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c] '''=>''' 1 NADP+[c] '''+''' 1 H+[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[CHC_T00008519001]] | ||
| + | ** Source: [[annotation-original_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | * Gene: [[CHC_T00008519001_1]] | ||
| + | ** Source: [[orthology-arabidopsis_thaliana]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-arabidopsis_thaliana]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-original_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=Ferredoxin-NADP+ oxidoreductase}} | |
| − | + | {{#set: ec number=EC-1.18.1.2}} | |
| − | {{#set: | + | {{#set: gene associated=CHC_T00008519001|CHC_T00008519001_1}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-original_genome|orthology-arabidopsis_thaliana}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
| − | {{#set: | + | |
Revision as of 16:52, 23 May 2018
Contents
Reaction RXN-17897
- direction:
- LEFT-TO-RIGHT
- common name:
- Ferredoxin-NADP+ oxidoreductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADPH[c] + 2 Oxidized-ferredoxins[c] => 1 NADP[c] + 1 PROTON[c] + 2 Reduced-ferredoxins[c]
- With common name(s):
- 1 NADPH[c] + 2 an oxidized ferredoxin [iron-sulfur] cluster[c] => 1 NADP+[c] + 1 H+[c] + 2 a reduced ferredoxin [iron-sulfur] cluster[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008519001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00008519001_1
- Source: orthology-arabidopsis_thaliana
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-arabidopsis_thaliana
- Tool: pantograph
- Source: orthology-arabidopsis_thaliana
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
