Difference between revisions of "CHC T00009444001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12121 CPD-12121] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...")
 
(Created page with "Category:Gene == Gene CHC_T00009444001_1 == * Synonym(s): == Reactions associated == * Reaction: GSHTRAN-RXN ** Source: orthology-galdieria.sulphuraria ** Source:...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12121 CPD-12121] ==
+
== Gene CHC_T00009444001_1 ==
−
* smiles:
+
−
** CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C
+
−
* inchi key:
+
−
** InChIKey=NKCMHMXWLADGOV-RVHIBIGXSA-N
+
−
* common name:
+
−
** demethylmenaquinol-12
+
−
* molecular weight:
+
−
** 977.59   
+
 
* Synonym(s):
 
* Synonym(s):
−
** DMK-12
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-9363]]
+
* Reaction: [[GSHTRAN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-galdieria.sulphuraria]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Reaction: [[GST-RXN]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Reaction: [[RXN-13673]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Reaction: [[RXN-15680]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479580 45479580]
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84551 84551]
+
−
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C}}
+
−
{{#set: inchi key=InChIKey=NKCMHMXWLADGOV-RVHIBIGXSA-N}}
+
−
{{#set: common name=demethylmenaquinol-12}}
+
−
{{#set: molecular weight=977.59    }}
+
−
{{#set: common name=DMK-12}}
+
−
{{#set: consumed by=RXN-9363}}
+

Latest revision as of 16:53, 23 May 2018

Gene CHC_T00009444001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00009444001_1&oldid=18416"