Difference between revisions of "CPD-5845"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12198 RXN-12198] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5845 CPD-5845] == * smiles: ** CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C([CH]=O)(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5845 CPD-5845] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C([CH]=O)(C)C(CCC(C)12)O))3))4)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HCOOTBJPHHNRCV-AQTSNUJDSA-N |
| + | * common name: | ||
| + | ** 3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carbaldehyde | ||
| + | * molecular weight: | ||
| + | ** 428.697 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-6269]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-6271]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * LIGAND- | + | * PUBCHEM: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145202 21145202] |
| − | {{#set: | + | * CHEBI: |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16286 16286] | |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11509 C11509] |
| − | {{#set: | + | {{#set: smiles=CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C([CH]=O)(C)C(CCC(C)12)O))3))4))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=HCOOTBJPHHNRCV-AQTSNUJDSA-N}} |
| − | {{#set: | + | {{#set: common name=3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carbaldehyde}} |
| + | {{#set: molecular weight=428.697 }} | ||
| + | {{#set: consumed by=RXN-6269}} | ||
| + | {{#set: produced by=RXN-6271}} | ||
Revision as of 17:54, 23 May 2018
Contents
Metabolite CPD-5845
- smiles:
- CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C([CH]=O)(C)C(CCC(C)12)O))3))4))
- inchi key:
- InChIKey=HCOOTBJPHHNRCV-AQTSNUJDSA-N
- common name:
- 3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carbaldehyde
- molecular weight:
- 428.697
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C([CH]=O)(C)C(CCC(C)12)O))3))4))" cannot be used as a page name in this wiki.
