Difference between revisions of "ExchangeSeed EDTA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14419 CPD-14419] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_EDTA ExchangeSeed_EDTA] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formu...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14419 CPD-14419] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_EDTA ExchangeSeed_EDTA] ==
* smiles:
+
* direction:
** CCC=CCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
* inchi key:
+
** InChIKey=AUKMTTJFPKEFDQ-IVICTRQZSA-J
+
* common name:
+
** 3R-hydroxy-icosatrienoyl-CoA
+
* molecular weight:
+
** 1067.974   
+
 
* Synonym(s):
 
* Synonym(s):
** 3R-hydroxy-(9Z,12Z,15Z)-octadecatrienoyl-CoA
 
** 3R-hydroxy-eicosatrienoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-12994]]
+
** 1.0 [[EDTA]][C-BOUNDARY] '''<=>''' 1.0 [[EDTA]][e]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 EDTA[C-BOUNDARY] '''<=>''' 1.0 EDTA[e]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-import_from_medium]]
 +
*** Comment: [[added to manage seeds from boundary to extracellular compartment]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551536 72551536]
+
{{#set: in pathway=}}
* CHEBI:
+
{{#set: reconstruction category=manual}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76455 76455]
+
{{#set: reconstruction source=manual-import_from_medium}}
{{#set: smiles=CCC=CCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction comment=added to manage seeds from boundary to extracellular compartment}}
{{#set: inchi key=InChIKey=AUKMTTJFPKEFDQ-IVICTRQZSA-J}}
+
{{#set: common name=3R-hydroxy-icosatrienoyl-CoA}}
+
{{#set: molecular weight=1067.974    }}
+
{{#set: common name=3R-hydroxy-(9Z,12Z,15Z)-octadecatrienoyl-CoA|3R-hydroxy-eicosatrienoyl-CoA}}
+
{{#set: produced by=RXN-12994}}
+

Latest revision as of 16:54, 23 May 2018

Reaction ExchangeSeed_EDTA

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 EDTA[C-BOUNDARY] <=> 1.0 EDTA[e]

Genes associated with this reaction

Pathways

Reconstruction information

External links