Difference between revisions of "CPD-11527"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17429 RXN-17429] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17429 RXN-17429] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/3.1.1.100 EC-3.1.1.100]
+
** InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J
 +
* common name:
 +
** OPC4-3-hydroxyacyl-CoA
 +
* molecular weight:
 +
** 999.813   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-10703]]
** 1 [[CHLOROPHYLLIDE-A]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[METOH]][c] '''+''' 1 [[CPD-18841]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-10705]]
** 1 chlorophyllide a[c] '''+''' 1 H2O[c] '''=>''' 1 CO2[c] '''+''' 1 methanol[c] '''+''' 1 8-ethyl-12-methyl-3-vinyl-bacteriochlorophyllide d[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-7758]], bacteriochlorophyll d biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7758 PWY-7758]
+
** '''2''' reactions found over '''14''' reactions in the full pathway
+
* [[PWY-7760]], bacteriochlorophyll e biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7760 PWY-7760]
+
** '''2''' reactions found over '''26''' reactions in the full pathway
+
* [[PWY-7759]], bacteriochlorophyll c biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7759 PWY-7759]
+
** '''2''' reactions found over '''18''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[gap-filling]]:
+
** [[meneco]]:
+
*** [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-3.1.1.100}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237301 44237301]
{{#set: in pathway=PWY-7758|PWY-7760|PWY-7759}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
{{#set: reconstruction category=gap-filling}}
+
{{#set: inchi key=InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J}}
{{#set: reconstruction tool=meneco}}
+
{{#set: common name=OPC4-3-hydroxyacyl-CoA}}
{{#set: reconstruction source=added for gapfilling}}
+
{{#set: molecular weight=999.813    }}
 +
{{#set: consumed by=RXN-10703}}
 +
{{#set: produced by=RXN-10705}}

Revision as of 16:56, 23 May 2018

Metabolite CPD-11527

  • smiles:
    • CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
  • inchi key:
    • InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J
  • common name:
    • OPC4-3-hydroxyacyl-CoA
  • molecular weight:
    • 999.813
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)" cannot be used as a page name in this wiki.