Difference between revisions of "Truncated-Limit-Dextrins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] == * smiles: ** C(C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OP(=O)(...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Truncated-Limit-Dextrins Truncated-Limit-Dextrins] == * common name: ** a α-limit dextrin...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Truncated-Limit-Dextrins Truncated-Limit-Dextrins] ==
* smiles:
+
** C(C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OP(=O)([O-])OP(=O)([O-])OC3(OC(C([O-])=O)C(O)C(O)C(O)3)
+
* inchi key:
+
** InChIKey=HDYANYHVCAPMJV-LXQIFKJMSA-K
+
 
* common name:
 
* common name:
** UDP-α-D-glucuronate
+
** a α-limit dextrin with short branches
* molecular weight:
+
** 577.265   
+
 
* Synonym(s):
 
* Synonym(s):
** (UDP-GlcA)1
 
** UDP-D-glucuronic acid
 
** UDP-glucuronic acid
 
** udp-glcua
 
** UDP-glucuronate
 
** uridine diphosphate glucuronate
 
** uridine diphosphate glucuronic acid
 
** UDP-D-glucuronate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UGD-RXN]]
+
* [[RXN-9023]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 2616-64-0
+
{{#set: common name=a α-limit dextrin with short branches}}
* METABOLIGHTS : MTBLC58052
+
{{#set: produced by=RXN-9023}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202620 25202620]
+
* HMDB : HMDB00935
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00167 C00167]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58052 58052]
+
* BIGG : udpglcur
+
{{#set: smiles=C(C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OP(=O)([O-])OP(=O)([O-])OC3(OC(C([O-])=O)C(O)C(O)C(O)3)}}
+
{{#set: inchi key=InChIKey=HDYANYHVCAPMJV-LXQIFKJMSA-K}}
+
{{#set: common name=UDP-α-D-glucuronate}}
+
{{#set: molecular weight=577.265    }}
+
{{#set: common name=(UDP-GlcA)1|UDP-D-glucuronic acid|UDP-glucuronic acid|udp-glcua|UDP-glucuronate|uridine diphosphate glucuronate|uridine diphosphate glucuronic acid|UDP-D-glucuronate}}
+
{{#set: produced by=UGD-RXN}}
+

Latest revision as of 16:56, 23 May 2018

Metabolite Truncated-Limit-Dextrins

  • common name:
    • a α-limit dextrin with short branches
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links