Difference between revisions of "CHC T00009320001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19159 CPD-19159] == * smiles: ** CCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
 
(Created page with "Category:Gene == Gene CHC_T00009320001 == * left end position: ** 393127 * transcription direction: ** POSITIVE * right end position: ** 394353 * centisome position: ** 70...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19159 CPD-19159] ==
+
== Gene CHC_T00009320001 ==
* smiles:
+
* left end position:
** CCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 393127
* inchi key:
+
* transcription direction:
** InChIKey=SCDXBWNPJAGEEK-KBOAXVDLSA-J
+
** POSITIVE
* common name:
+
* right end position:
** (S)-3-hydroxy-(11Z)-octadecenoyl-CoA
+
** 394353
* molecular weight:
+
* centisome position:
** 1043.952    
+
** 70.553894    
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-18:1-Δ11-CoA
 
** (S)-3-hydroxy-11-cis-octadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17786]]
+
* Reaction: [[RXN-6501]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
* [[RXN-17785]]
+
*** Assignment: automated-name-match
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY1G-0]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=393127}}
{{#set: inchi key=InChIKey=SCDXBWNPJAGEEK-KBOAXVDLSA-J}}
+
{{#set: transcription direction=POSITIVE}}
{{#set: common name=(S)-3-hydroxy-(11Z)-octadecenoyl-CoA}}
+
{{#set: right end position=394353}}
{{#set: molecular weight=1043.952   }}
+
{{#set: centisome position=70.553894   }}
{{#set: common name=(S)-3-hydroxy-18:1-Δ11-CoA|(S)-3-hydroxy-11-cis-octadecenoyl-CoA}}
+
{{#set: reaction associated=RXN-6501}}
{{#set: consumed by=RXN-17786}}
+
{{#set: pathway associated=PWY1G-0}}
{{#set: produced by=RXN-17785}}
+

Latest revision as of 17:56, 23 May 2018

Gene CHC_T00009320001

  • left end position:
    • 393127
  • transcription direction:
    • POSITIVE
  • right end position:
    • 394353
  • centisome position:
    • 70.553894
  • Synonym(s):

Reactions associated

Pathways associated

External links