Difference between revisions of "RXN66-181"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-8-DIHYDROPTEROATE 7-8-DIHYDROPTEROATE] == * smiles: ** C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-181 RXN66-181] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-8-DIHYDROPTEROATE 7-8-DIHYDROPTEROATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-181 RXN66-181] ==
* smiles:
+
* direction:
** C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=WBFYVDCHGVNRBH-UHFFFAOYSA-M
+
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
* common name:
+
** 7,8-dihydropteroate
+
* molecular weight:
+
** 313.295   
+
 
* Synonym(s):
 
* Synonym(s):
** dihydropterate
 
** H2Pte
 
** dihydropteroate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[DIHYDROFOLATESYNTH-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[CPD-3481]][c] '''=>''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-3483]][c]
* [[H2PTEROATESYNTH-RXN]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 oxygen[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 bupropion[c] '''=>''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 H2O[c] '''+''' 1 hydroxybupropion[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008302001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00008799001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00009144001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY66-241]], bupropion degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-241 PWY66-241]
 +
** '''1''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459950 5459950]
+
{{#set: ec number=EC-1.14.14.1}}
* HMDB : HMDB01412
+
{{#set: gene associated=CHC_T00008302001_1|CHC_T00008799001_1|CHC_T00009144001_1}}
* LIGAND-CPD:
+
{{#set: in pathway=PWY66-241}}
** [http://www.genome.jp/dbget-bin/www_bget?C00921 C00921]
+
{{#set: reconstruction category=orthology}}
* CHEMSPIDER:
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
** [http://www.chemspider.com/Chemical-Structure.4573669.html 4573669]
+
{{#set: reconstruction tool=pantograph}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17839 17839]
+
* BIGG : dhpt
+
{{#set: smiles=C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))}}
+
{{#set: inchi key=InChIKey=WBFYVDCHGVNRBH-UHFFFAOYSA-M}}
+
{{#set: common name=7,8-dihydropteroate}}
+
{{#set: molecular weight=313.295    }}
+
{{#set: common name=dihydropterate|H2Pte|dihydropteroate}}
+
{{#set: consumed by=DIHYDROFOLATESYNTH-RXN}}
+
{{#set: produced by=H2PTEROATESYNTH-RXN}}
+

Latest revision as of 17:56, 23 May 2018

Reaction RXN66-181

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-241, bupropion degradation: PWY66-241
    • 1 reactions found over 5 reactions in the full pathway

Reconstruction information

External links