Difference between revisions of "CPD-7107"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN1HP7-25 TRANS-RXN1HP7-25] == * direction: ** LEFT-TO-RIGHT * common name: ** TRANS-RXN1HP7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C * inch...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C |
| + | * inchi key: | ||
| + | ** InChIKey=KKFIZYKKQLWBKH-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** diprenylphlorisobutyrophenone |
| + | * molecular weight: | ||
| + | ** 331.431 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** deoxycohumulone | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-7813]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203729 25203729] |
| − | {{#set: | + | {{#set: smiles=CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=KKFIZYKKQLWBKH-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: common name=diprenylphlorisobutyrophenone}} |
| − | {{#set: | + | {{#set: molecular weight=331.431 }} |
| − | {{#set: | + | {{#set: common name=deoxycohumulone}} |
| + | {{#set: produced by=RXN-7813}} | ||
Revision as of 16:57, 23 May 2018
Contents
Metabolite CPD-7107
- smiles:
- CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C
- inchi key:
- InChIKey=KKFIZYKKQLWBKH-UHFFFAOYSA-M
- common name:
- diprenylphlorisobutyrophenone
- molecular weight:
- 331.431
- Synonym(s):
- deoxycohumulone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(C(C)C)=O)O))C" cannot be used as a page name in this wiki.
