Difference between revisions of "CHC T00008714001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-676 CPD-676] == * smiles: ** C([O-])(=O)C=CC1(C=C(O)C(O)=CC=1) * inchi key: ** InChIKey=QAI...") |
(Created page with "Category:Gene == Gene CHC_T00008714001_1 == * Synonym(s): == Reactions associated == * Reaction: 5-METHYLTHIOADENOSINE-PHOSPHORYLASE-RXN ** Source: orthology-galdie...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008714001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[5-METHYLTHIOADENOSINE-PHOSPHORYLASE-RXN]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | == | + | * Reaction: [[RXN-14304]] |
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6756]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=5-METHYLTHIOADENOSINE-PHOSPHORYLASE-RXN|RXN-14304}} | |
− | + | {{#set: pathway associated=PWY-6756}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 17:57, 23 May 2018
Gene CHC_T00008714001_1
- Synonym(s):
Reactions associated
- Reaction: 5-METHYLTHIOADENOSINE-PHOSPHORYLASE-RXN
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN-14304
- Source: orthology-galdieria.sulphuraria