Difference between revisions of "Bromide"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Bromide Bromide] == * common name: ** an organobromine compound * Synonym(s): ** RBr == Reacti...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Bromide Bromide] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an organobromine compound |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** RBr |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-11329]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=an organobromine compound}} | |
− | + | {{#set: common name=RBr}} | |
− | + | {{#set: produced by=RXN-11329}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: produced by= | + | |
− | + |
Latest revision as of 17:58, 23 May 2018
Contents
Metabolite Bromide
- common name:
- an organobromine compound
- Synonym(s):
- RBr