Difference between revisions of "RXN-11246"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15834 CPD-15834] == * smiles: ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11246 RXN-11246] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15834 CPD-15834] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11246 RXN-11246] ==
−
* smiles:
+
* direction:
−
** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N
+
** [http://enzyme.expasy.org/EC/2.3.1.16 EC-2.3.1.16]
−
* common name:
+
−
** 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol
+
−
* molecular weight:
+
−
** 410.639   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-14917]]
+
** 1 [[CO-A]][c] '''+''' 1 [[CPD-10600]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[CPD-201]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 coenzyme A[c] '''+''' 1 4-hydroxybenzoyl-acetyl-CoA[c] '''=>''' 1 acetyl-CoA[c] '''+''' 1 4-hydroxybenzoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009349001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00009422001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-6435]], 4-hydroxybenzoate biosynthesis V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6435 PWY-6435]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C20738 C20738]
+
{{#set: ec number=EC-2.3.1.16}}
−
* CHEBI:
+
{{#set: gene associated=CHC_T00009349001_1|CHC_T00009422001_1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75412 75412]
+
{{#set: in pathway=PWY-6435}}
−
* PUBCHEM:
+
{{#set: reconstruction category=orthology}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5327035 5327035]
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
−
{{#set: smiles=CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N}}
+
−
{{#set: common name=2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol}}
+
−
{{#set: molecular weight=410.639    }}
+
−
{{#set: produced by=RXN-14917}}
+

Latest revision as of 16:58, 23 May 2018

Reaction RXN-11246

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 coenzyme A[c] + 1 4-hydroxybenzoyl-acetyl-CoA[c] => 1 acetyl-CoA[c] + 1 4-hydroxybenzoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6435, 4-hydroxybenzoate biosynthesis V: PWY-6435
    • 4 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-11246&oldid=18708"