Difference between revisions of "CHC T00008954001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19339 CPD-19339] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)C(CO)(O)O1) * common nam...") |
(Created page with "Category:Gene == Gene CHC_T00008954001 == * left end position: ** 425122 * transcription direction: ** NEGATIVE * right end position: ** 427281 * centisome position: ** 70...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008954001 == |
− | * | + | * left end position: |
− | ** | + | ** 425122 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 427281 |
− | * | + | * centisome position: |
− | ** | + | ** 70.88734 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[NAD-SYNTH-GLN-RXN]] |
− | == | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | == Pathways associated == | |
− | * [[ | + | * [[PWY-5653]] |
− | * [[ | + | * [[PWY-5381]] |
+ | * [[PYRIDNUCSYN-PWY]] | ||
+ | * [[PWY-7761]] | ||
+ | * [[PYRIDNUCSAL-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=425122}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: right end position=427281}} |
− | {{#set: | + | {{#set: centisome position=70.88734 }} |
− | {{#set: | + | {{#set: reaction associated=NAD-SYNTH-GLN-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY-5653|PWY-5381|PYRIDNUCSYN-PWY|PWY-7761|PYRIDNUCSAL-PWY}} |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 17:59, 23 May 2018
Gene CHC_T00008954001
- left end position:
- 425122
- transcription direction:
- NEGATIVE
- right end position:
- 427281
- centisome position:
- 70.88734
- Synonym(s):
Reactions associated
- Reaction: NAD-SYNTH-GLN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome