Difference between revisions of "CHC T00006203001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == * smiles: ** C([N+])CCCC([N+])C([O-])=O * inchi key: ** InChIKey=KDXKERNSBIXSRK-YFK...") |
(Created page with "Category:Gene == Gene CHC_T00006203001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN-13039 ** Source: orthology-galdieria.sulphuraria * Reaction:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00006203001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-13039]] |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | * [[ | + | * Reaction: [[RXN-17127]] |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | + | * Reaction: [[RXN-8654]] | |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | == | + | * Reaction: [[RXN-8655]] |
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Reaction: [[RXN0-1141]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Reaction: [[RXN0-5098]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6984]] | ||
+ | * [[PWY0-522]] | ||
+ | * [[PWY0-1275]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-13039|RXN-17127|RXN-8654|RXN-8655|RXN0-1141|RXN0-5098}} | |
− | + | {{#set: pathway associated=PWY-6984|PWY0-522|PWY0-1275}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 18:00, 23 May 2018
Gene CHC_T00006203001_1
- Synonym(s):
Reactions associated
- Reaction: RXN-13039
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN-17127
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN-8654
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN-8655
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN0-1141
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN0-5098
- Source: orthology-galdieria.sulphuraria