Difference between revisions of "CPD-8843"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17387 CPD-17387] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8843 CPD-8843] == * smiles: ** C=CC(CCC=C(CCC=C(C)C)C)(O)C * common name: ** (3R,6E)-neroli...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8843 CPD-8843] == |
* smiles: | * smiles: | ||
− | ** | + | ** C=CC(CCC=C(CCC=C(C)C)C)(O)C |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** ( | + | ** (3R,6E)-nerolidol |
+ | * inchi key: | ||
+ | ** InChIKey=FQTLCLSUCSAZDY-GOFCXVBSSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 222.37 |
* Synonym(s): | * Synonym(s): | ||
− | ** ( | + | ** (E)-nerolidol |
+ | ** (3R)-(E)-nerolidol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-8619]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-11575]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19746 C19746] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.9416582.html 9416582] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59959 59959] |
− | {{#set: smiles= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11241545 11241545] |
− | {{#set: | + | {{#set: smiles=C=CC(CCC=C(CCC=C(C)C)C)(O)C}} |
− | {{#set: molecular weight= | + | {{#set: common name=(3R,6E)-nerolidol}} |
− | {{#set: common name=( | + | {{#set: inchi key=InChIKey=FQTLCLSUCSAZDY-GOFCXVBSSA-N}} |
− | {{#set: produced by=RXN- | + | {{#set: molecular weight=222.37 }} |
+ | {{#set: common name=(E)-nerolidol|(3R)-(E)-nerolidol}} | ||
+ | {{#set: consumed by=RXN-8619}} | ||
+ | {{#set: produced by=RXN-11575}} |
Revision as of 17:02, 23 May 2018
Contents
Metabolite CPD-8843
- smiles:
- C=CC(CCC=C(CCC=C(C)C)C)(O)C
- common name:
- (3R,6E)-nerolidol
- inchi key:
- InChIKey=FQTLCLSUCSAZDY-GOFCXVBSSA-N
- molecular weight:
- 222.37
- Synonym(s):
- (E)-nerolidol
- (3R)-(E)-nerolidol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links