Difference between revisions of "RXN66-336"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-219 CPD-219] == * smiles: ** C([N+])CCCC([N+])C([O-])=O * inchi key: ** InChIKey=KDXKERNSBI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-336 RXN66-336] == * direction: ** LEFT-TO-RIGHT * common name: ** leukotriene-C4 gamma-glutam...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-336 RXN66-336] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** leukotriene-C4 gamma-glutamyl transferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.2.2 EC-2.3.2.2] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[Amino-Acids-20]][c] '''+''' 1 [[LEUKOTRIENE-C4]][c] '''=>''' 1 [[5-L-GLUTAMYL-L-AMINO-ACID]][c] '''+''' 1 [[CPD66-21]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a proteinogenic amino acid[c] '''+''' 1 leukotriene-C4[c] '''=>''' 1 an (γ-L-glutamyl)-L-amino acid[c] '''+''' 1 leukotriene-D4[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00000071001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00005245001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | * [[PWY66-375]], leukotriene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-375 PWY66-375] | ||
+ | ** '''2''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=leukotriene-C4 gamma-glutamyl transferase}} | |
− | + | {{#set: ec number=EC-2.3.2.2}} | |
− | + | {{#set: gene associated=CHC_T00000071001_1|CHC_T00005245001_1}} | |
− | + | {{#set: in pathway=PWY66-375}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:02, 23 May 2018
Contents
Reaction RXN66-336
- direction:
- LEFT-TO-RIGHT
- common name:
- leukotriene-C4 gamma-glutamyl transferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Amino-Acids-20[c] + 1 LEUKOTRIENE-C4[c] => 1 5-L-GLUTAMYL-L-AMINO-ACID[c] + 1 CPD66-21[c]
- With common name(s):
- 1 a proteinogenic amino acid[c] + 1 leukotriene-C4[c] => 1 an (γ-L-glutamyl)-L-amino acid[c] + 1 leukotriene-D4[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00000071001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00005245001_1
- Source: orthology-galdieria.sulphuraria
Pathways
- PWY66-375, leukotriene biosynthesis: PWY66-375
- 2 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus