Difference between revisions of "CPD-14736"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-MALEYL-ACETOACETATE 4-MALEYL-ACETOACETATE] == * smiles: ** C([O-])(=O)C=CC(=O)CC(=O)CC([O-])=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14736 CPD-14736] == * smiles: ** C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1) * inchi key: ** I...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14736 CPD-14736] == |
* smiles: | * smiles: | ||
| − | ** C([O-])( | + | ** C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=YGPSJZOEDVAXAB-QMMMGPOBSA-N |
* common name: | * common name: | ||
| − | ** | + | ** L-kynurenine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 208.216 |
* Synonym(s): | * Synonym(s): | ||
| + | ** kynurenine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[KYNURENINE-3-MONOOXYGENASE-RXN]] |
| + | * [[KYNURENINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 343-65-7 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971029 6971029] |
| − | * HMDB : | + | * HMDB : HMDB00684 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01718 C01718] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57959 57959] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC57959 |
| − | {{#set: smiles=C([O-])( | + | {{#set: smiles=C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1)}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=YGPSJZOEDVAXAB-QMMMGPOBSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=L-kynurenine}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=208.216 }} |
| − | {{#set: | + | {{#set: common name=kynurenine}} |
| − | {{#set: | + | {{#set: consumed by=KYNURENINE-3-MONOOXYGENASE-RXN|KYNURENINASE-RXN}} |
Revision as of 17:02, 23 May 2018
Contents
Metabolite CPD-14736
- smiles:
- C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1)
- inchi key:
- InChIKey=YGPSJZOEDVAXAB-QMMMGPOBSA-N
- common name:
- L-kynurenine
- molecular weight:
- 208.216
- Synonym(s):
- kynurenine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 343-65-7
- PUBCHEM:
- HMDB : HMDB00684
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57959
"C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1)" cannot be used as a page name in this wiki.
