Difference between revisions of "CPD-14419"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14419 CPD-14419] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
|||
| Line 1: | Line 1: | ||
| + | [[Category:Metabolite]] | ||
| + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14419 CPD-14419] == | ||
| + | * smiles: | ||
| + | ** CCC=CCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=AUKMTTJFPKEFDQ-IVICTRQZSA-J | ||
| + | * common name: | ||
| + | ** 3R-hydroxy-icosatrienoyl-CoA | ||
| + | * molecular weight: | ||
| + | ** 1067.974 | ||
| + | * Synonym(s): | ||
| + | ** 3R-hydroxy-(9Z,12Z,15Z)-octadecatrienoyl-CoA | ||
| + | ** 3R-hydroxy-eicosatrienoyl-CoA | ||
| + | == Reaction(s) known to consume the compound == | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12994]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | == External links == | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551536 72551536] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76455 76455] | ||
| + | {{#set: smiles=CCC=CCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=AUKMTTJFPKEFDQ-IVICTRQZSA-J}} | ||
| + | {{#set: common name=3R-hydroxy-icosatrienoyl-CoA}} | ||
| + | {{#set: molecular weight=1067.974 }} | ||
| + | {{#set: common name=3R-hydroxy-(9Z,12Z,15Z)-octadecatrienoyl-CoA|3R-hydroxy-eicosatrienoyl-CoA}} | ||
| + | {{#set: produced by=RXN-12994}} | ||
Revision as of 17:03, 23 May 2018
Contents
Metabolite CPD-14419
- smiles:
- CCC=CCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=AUKMTTJFPKEFDQ-IVICTRQZSA-J
- common name:
- 3R-hydroxy-icosatrienoyl-CoA
- molecular weight:
- 1067.974
- Synonym(s):
- 3R-hydroxy-(9Z,12Z,15Z)-octadecatrienoyl-CoA
- 3R-hydroxy-eicosatrienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
