Difference between revisions of "CPD-6701"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * inchi key: **...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5698 PWY-5698] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
* inchi key:
 +
** InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L
 
* common name:
 
* common name:
−
** allantoin degradation to ureidoglycolate II (ammonia producing)
+
** 1D-myo-inositol 5-monophosphate
 +
* molecular weight:
 +
** 258.121   
 
* Synonym(s):
 
* Synonym(s):
 +
** D-myo-inositol 5-monophosphate
 +
** Ins(5)P1
 +
** 1D-myo-inositol 5-phosphate
 +
** Ins(5)P
 +
** Ins5P
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''3''' reactions in the full pathway
+
* [[RXN-10953]]
−
* [[ALLANTOINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
−
* [http://metacyc.org/META/NEW-IMAGE?object=ALLANTOATE-DEIMINASE-RXN ALLANTOATE-DEIMINASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=URUR-RXN URUR-RXN]
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5698 PWY-5698]
+
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L}}
−
{{#set: taxonomic range=TAX-2}}
+
{{#set: common name=1D-myo-inositol 5-monophosphate}}
−
{{#set: taxonomic range=TAX-2759}}
+
{{#set: molecular weight=258.121    }}
−
{{#set: common name=allantoin degradation to ureidoglycolate II (ammonia producing)}}
+
{{#set: common name=D-myo-inositol 5-monophosphate|Ins(5)P1|1D-myo-inositol 5-phosphate|Ins(5)P|Ins5P}}
−
{{#set: reaction found=1}}
+
{{#set: consumed by=RXN-10953}}
−
{{#set: reaction not found=3}}
+
−
{{#set: completion rate=33.0}}
+

Revision as of 15:09, 23 May 2018

Metabolite CPD-6701

  • smiles:
    • C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
  • inchi key:
    • InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L
  • common name:
    • 1D-myo-inositol 5-monophosphate
  • molecular weight:
    • 258.121
  • Synonym(s):
    • D-myo-inositol 5-monophosphate
    • Ins(5)P1
    • 1D-myo-inositol 5-phosphate
    • Ins(5)P
    • Ins5P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-6701&oldid=13457"