Difference between revisions of "CPD-13171"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] == * smiles: ** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C...") |
|||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C |
+ | * inchi key: | ||
+ | ** InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 15,9'-di-cis-phytofluene |
+ | * molecular weight: | ||
+ | ** 542.93 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-12244]] | |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12243]] | |
− | * [[RXN- | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19765 C19765] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61990 61990] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=51351778 51351778] |
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N}} | ||
+ | {{#set: common name=15,9'-di-cis-phytofluene}} | ||
+ | {{#set: molecular weight=542.93 }} | ||
+ | {{#set: consumed by=RXN-12244}} | ||
+ | {{#set: produced by=RXN-12243}} |
Revision as of 15:52, 23 May 2018
Contents
Metabolite CPD-13171
- smiles:
- CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C
- inchi key:
- InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N
- common name:
- 15,9'-di-cis-phytofluene
- molecular weight:
- 542.93
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links