Difference between revisions of "CPD-13171"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] == * smiles: ** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6724 PWY-6724] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C
 +
* inchi key:
 +
** InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N
 
* common name:
 
* common name:
** starch degradation II
+
** 15,9'-di-cis-phytofluene
 +
* molecular weight:
 +
** 542.93   
 
* Synonym(s):
 
* Synonym(s):
** starch mobilization in chloroplast stroma
 
** transitory starch degradation in chloroplast stroma
 
** starch degradation in chloroplast stroma
 
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''6''' reactions found over '''9''' reactions in the full pathway
+
* [[RXN-12244]]
* [[RXN-12203]]
+
== Reaction(s) known to produce the compound ==
* [[RXN-12278]]
+
* [[RXN-12243]]
* [[RXN-12279]]
+
== Reaction(s) of unknown directionality ==
* [[RXN-12280]]
+
* [[RXN-12384]]
+
* [[RXN-12391]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12204 RXN-12204]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12276 RXN-12276]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12277 RXN-12277]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33090}}
+
* LIGAND-CPD:
{{#set: common name=starch degradation II}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C19765 C19765]
{{#set: common name=starch mobilization in chloroplast stroma|transitory starch degradation in chloroplast stroma|starch degradation in chloroplast stroma}}
+
* CHEBI:
{{#set: reaction found=6}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61990 61990]
{{#set: reaction not found=9}}
+
* PUBCHEM:
{{#set: completion rate=67.0}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=51351778 51351778]
 +
{{#set: smiles=CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C}}
 +
{{#set: inchi key=InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N}}
 +
{{#set: common name=15,9'-di-cis-phytofluene}}
 +
{{#set: molecular weight=542.93    }}
 +
{{#set: consumed by=RXN-12244}}
 +
{{#set: produced by=RXN-12243}}

Revision as of 15:52, 23 May 2018

Metabolite CPD-13171

  • smiles:
    • CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C
  • inchi key:
    • InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N
  • common name:
    • 15,9'-di-cis-phytofluene
  • molecular weight:
    • 542.93
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links