Difference between revisions of "CPD-14423"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14423 CPD-14423] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(...") |
|||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14423 CPD-14423] == |
− | * | + | * smiles: |
− | ** [ | + | ** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=SLYKKQSPRFJDAF-HVGANWHPSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 3-oxo-docosapentaenoyl-CoA |
+ | * molecular weight: | ||
+ | ** 1089.98 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (5Z,8Z,11Z,14Z,17Z)-3-oxo-docosa-5,8,11,14,17-pentaenoyl-CoA | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-13443]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581097 71581097] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73863 73863] |
− | {{#set: | + | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
+ | {{#set: inchi key=InChIKey=SLYKKQSPRFJDAF-HVGANWHPSA-J}} | ||
+ | {{#set: common name=3-oxo-docosapentaenoyl-CoA}} | ||
+ | {{#set: molecular weight=1089.98 }} | ||
+ | {{#set: common name=(5Z,8Z,11Z,14Z,17Z)-3-oxo-docosa-5,8,11,14,17-pentaenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-13443}} |
Revision as of 16:53, 23 May 2018
Contents
Metabolite CPD-14423
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=SLYKKQSPRFJDAF-HVGANWHPSA-J
- common name:
- 3-oxo-docosapentaenoyl-CoA
- molecular weight:
- 1089.98
- Synonym(s):
- (5Z,8Z,11Z,14Z,17Z)-3-oxo-docosa-5,8,11,14,17-pentaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.