Difference between revisions of "P-COUMAROYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] | ||
| + | * molecular weight: | ||
| + | ** 909.648 | ||
* inchi key: | * inchi key: | ||
** InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J | ** InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J | ||
* common name: | * common name: | ||
** 4-coumaroyl-CoA | ** 4-coumaroyl-CoA | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** p-coumaroyl-CoA | ** p-coumaroyl-CoA | ||
| Line 16: | Line 16: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN-1101]] | * [[RXN-1101]] | ||
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]] | * [[NARINGENIN-CHALCONE-SYNTHASE-RXN]] | ||
| + | * [[RXN-11244]] | ||
* [[RXN-3142]] | * [[RXN-3142]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| Line 24: | Line 24: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15499 15499] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15499 15499] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266584 45266584] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C00223 C00223] | ** [http://www.genome.jp/dbget-bin/www_bget?C00223 C00223] | ||
* HMDB : HMDB60153 | * HMDB : HMDB60153 | ||
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | ||
| + | {{#set: molecular weight=909.648 }} | ||
{{#set: inchi key=InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J}} | {{#set: inchi key=InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J}} | ||
{{#set: common name=4-coumaroyl-CoA}} | {{#set: common name=4-coumaroyl-CoA}} | ||
| − | |||
{{#set: common name=p-coumaroyl-CoA|4-hydroxycinnamoyl-CoA|4-coumaryl-CoA|p-coumaryl-CoA}} | {{#set: common name=p-coumaroyl-CoA|4-hydroxycinnamoyl-CoA|4-coumaryl-CoA|p-coumaryl-CoA}} | ||
| − | {{#set: consumed by= | + | {{#set: consumed by=RXN-1101|NARINGENIN-CHALCONE-SYNTHASE-RXN|RXN-11244|RXN-3142}} |
{{#set: produced by=4-COUMARATE--COA-LIGASE-RXN}} | {{#set: produced by=4-COUMARATE--COA-LIGASE-RXN}} | ||
Latest revision as of 15:08, 9 January 2019
Contents
Metabolite P-COUMAROYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- molecular weight:
- 909.648
- inchi key:
- InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J
- common name:
- 4-coumaroyl-CoA
- Synonym(s):
- p-coumaroyl-CoA
- 4-hydroxycinnamoyl-CoA
- 4-coumaryl-CoA
- p-coumaryl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.
