Difference between revisions of "CPD-7061"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7061 CPD-7061] == * smiles: ** C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6)))))) | ** C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6)))))) | ||
| + | * molecular weight: | ||
| + | ** 590.677 | ||
* inchi key: | * inchi key: | ||
** InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M | ** InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M | ||
* common name: | * common name: | ||
** pheophorbide a | ** pheophorbide a | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** pheide a | ** pheide a | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN-7740]] | * [[RXN-7740]] | ||
| + | * [[RXN-17252]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58687 58687] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58687 58687] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658422 90658422] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C18021 C18021] | ** [http://www.genome.jp/dbget-bin/www_bget?C18021 C18021] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4481064.html 4481064] | ||
{{#set: smiles=C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))}} | {{#set: smiles=C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))}} | ||
| + | {{#set: molecular weight=590.677 }} | ||
{{#set: inchi key=InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M}} | {{#set: inchi key=InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M}} | ||
{{#set: common name=pheophorbide a}} | {{#set: common name=pheophorbide a}} | ||
| − | |||
{{#set: common name=pheide a}} | {{#set: common name=pheide a}} | ||
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-7740|RXN-17252}} |
Latest revision as of 15:29, 9 January 2019
Contents
Metabolite CPD-7061
- smiles:
- C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))
- molecular weight:
- 590.677
- inchi key:
- InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M
- common name:
- pheophorbide a
- Synonym(s):
- pheide a
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))" cannot be used as a page name in this wiki.
