Difference between revisions of "CPD-7417"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VANILLYL_MANDELATE VANILLYL_MANDELATE] == * smiles: ** COC1(C(O)=CC=C(C=1)C(O)C(=O)[O-]) * inch...") |
(Created page with "Category:Gene == Gene CHC_T00008525001_1 == * Synonym(s): == Reactions associated == * SULFITE-REDUCTASE-FERREDOXIN-RXN ** pantograph-galdieria.sulphuraria **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008525001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[SULFITE-REDUCTASE-FERREDOXIN-RXN]] | |
− | * [[RXN- | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
− | == | + | ** [[pantograph]]-[[a.taliana]] |
+ | == Pathways associated == | ||
+ | * [[SULFMETII-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=SULFITE-REDUCTASE-FERREDOXIN-RXN}} | |
− | + | {{#set: pathway associated=SULFMETII-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 11:58, 18 January 2018
Gene CHC_T00008525001_1
- Synonym(s):