Difference between revisions of "DOPAQUINONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * smiles: ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) * inchi key: *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) | ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) | ||
| + | * molecular weight: | ||
| + | ** 195.174 | ||
* inchi key: | * inchi key: | ||
** InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N | ** InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N | ||
* common name: | * common name: | ||
** dopaquinone | ** dopaquinone | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
* [[MONOPHENOL-MONOOXYGENASE-RXN]] | * [[MONOPHENOL-MONOOXYGENASE-RXN]] | ||
| + | * [[RXN-13061]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57924 57924] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57924 57924] | ||
| Line 24: | Line 22: | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229226 44229226] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229226 44229226] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00822 C00822] | ||
* HMDB : HMDB01229 | * HMDB : HMDB01229 | ||
{{#set: smiles=C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1)}} | {{#set: smiles=C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1)}} | ||
| + | {{#set: molecular weight=195.174 }} | ||
{{#set: inchi key=InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N}} | {{#set: inchi key=InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N}} | ||
{{#set: common name=dopaquinone}} | {{#set: common name=dopaquinone}} | ||
| − | + | {{#set: produced by=MONOPHENOL-MONOOXYGENASE-RXN|RXN-13061}} | |
| − | {{#set: produced by= | + | |
Latest revision as of 15:53, 9 January 2019
Contents
Metabolite DOPAQUINONE
- smiles:
- C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1)
- molecular weight:
- 195.174
- inchi key:
- InChIKey=AHMIDUVKSGCHAU-LURJTMIESA-N
- common name:
- dopaquinone
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1)" cannot be used as a page name in this wiki.
