Difference between revisions of "CPD-706"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ||
+ | * molecular weight: | ||
+ | ** 398.671 | ||
* inchi key: | * inchi key: | ||
** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N | ** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N | ||
* common name: | * common name: | ||
** 24-methylenecholesterol | ** 24-methylenecholesterol | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-4222]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-707]] | * [[RXN-707]] | ||
+ | * [[extended_2.1.1.143-RXN_CPD-707]] | ||
+ | * [[extended_2.1.1.143-RXN_DESMOSTEROL-CPD]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
Line 22: | Line 25: | ||
* HMDB : HMDB06849 | * HMDB : HMDB06849 | ||
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: molecular weight=398.671 }} | ||
{{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}} | {{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}} | ||
{{#set: common name=24-methylenecholesterol}} | {{#set: common name=24-methylenecholesterol}} | ||
− | {{#set: | + | {{#set: consumed by=RXN-4222}} |
− | {{#set: produced by=RXN-707}} | + | {{#set: produced by=RXN-707|extended_2.1.1.143-RXN_CPD-707|extended_2.1.1.143-RXN_DESMOSTEROL-CPD}} |
Latest revision as of 16:59, 9 January 2019
Contents
Metabolite CPD-706
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 398.671
- inchi key:
- InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
- common name:
- 24-methylenecholesterol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.