Difference between revisions of "CALVIN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == * smiles: ** CC(=CCCC(=CCOP([O-])(OP(=O)([O-])[O-])=O)C)C * inchi key...") |
(Created page with "Category:Gene == Gene CHC_T00008437001_1 == * Synonym(s): == Reactions associated == * PEPCARBOX-RXN ** pantograph-galdieria.sulphuraria == Pathways associate...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008437001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PEPCARBOX-RXN]] |
− | * [[ | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
− | == | + | == Pathways associated == |
− | + | * [[PWY-5913]] | |
− | * [[ | + | * [[PWY-1622]] |
+ | * [[PWYQT-4429]] | ||
+ | * [[PWY-6549]] | ||
+ | * [[PWY-241]] | ||
+ | * [[P23-PWY]] | ||
+ | * [[FERMENTATION-PWY]] | ||
+ | * [[PWY-7115]] | ||
+ | * [[PWY-6142]] | ||
+ | * [[PWY-7124]] | ||
+ | * [[PWY-6146]] | ||
+ | * [[PWY-7117]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=PEPCARBOX-RXN}} | |
− | + | {{#set: pathway associated=PWY-5913|PWY-1622|PWYQT-4429|PWY-6549|PWY-241|P23-PWY|FERMENTATION-PWY|PWY-7115|PWY-6142|PWY-7124|PWY-6146|PWY-7117}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 10:59, 18 January 2018
Gene CHC_T00008437001_1
- Synonym(s):
Reactions associated
Pathways associated
- PWY-5913
- PWY-1622
- PWYQT-4429
- PWY-6549
- PWY-241
- P23-PWY
- FERMENTATION-PWY
- PWY-7115
- PWY-6142
- PWY-7124
- PWY-6146
- PWY-7117