Difference between revisions of "CPD-3188"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Saturated-Fatty-Acyl-CoA Odd-Saturated-Fatty-Acyl-CoA] == * common name: ** an odd numbered...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * inchi key: ** InChIKey=VYOIE...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == |
+ | * smiles: | ||
+ | ** C1(NC=NC=1CC([CH]=O)[N+]) | ||
+ | * inchi key: | ||
+ | ** InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O | ||
* common name: | * common name: | ||
− | ** | + | ** histidinal |
+ | * molecular weight: | ||
+ | ** 140.164 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** L-histidinal | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[HISTALDEHYD-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[HISTOLDEHYD-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339283 57339283] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64802 64802] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01929 C01929] | ||
+ | * HMDB : HMDB12234 | ||
+ | {{#set: smiles=C1(NC=NC=1CC([CH]=O)[N+])}} | ||
+ | {{#set: inchi key=InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O}} | ||
+ | {{#set: common name=histidinal}} | ||
+ | {{#set: molecular weight=140.164 }} | ||
+ | {{#set: common name=L-histidinal}} | ||
+ | {{#set: consumed by=HISTALDEHYD-RXN}} | ||
+ | {{#set: consumed or produced by=HISTOLDEHYD-RXN}} |
Revision as of 11:00, 18 January 2018
Contents
Metabolite HISTIDINAL
- smiles:
- C1(NC=NC=1CC([CH]=O)[N+])
- inchi key:
- InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O
- common name:
- histidinal
- molecular weight:
- 140.164
- Synonym(s):
- L-histidinal
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC=NC=1CC([CH]=O)[N+])" cannot be used as a page name in this wiki.