Difference between revisions of "CPD-3188"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Saturated-Fatty-Acyl-CoA Odd-Saturated-Fatty-Acyl-CoA] == * common name: ** an odd numbered...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * inchi key: ** InChIKey=VYOIE...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Saturated-Fatty-Acyl-CoA Odd-Saturated-Fatty-Acyl-CoA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] ==
 +
* smiles:
 +
** C1(NC=NC=1CC([CH]=O)[N+])
 +
* inchi key:
 +
** InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O
 
* common name:
 
* common name:
** an odd numbered straight chain 2,3,4-saturated fatty acyl CoA
+
** histidinal
 +
* molecular weight:
 +
** 140.164   
 
* Synonym(s):
 
* Synonym(s):
 +
** L-histidinal
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[HISTALDEHYD-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-477]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[HISTOLDEHYD-RXN]]
 
== External links  ==
 
== External links  ==
{{#set: common name=an odd numbered straight chain 2,3,4-saturated fatty acyl CoA}}
+
* PUBCHEM:
{{#set: produced by=RXN66-477}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339283 57339283]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64802 64802]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01929 C01929]
 +
* HMDB : HMDB12234
 +
{{#set: smiles=C1(NC=NC=1CC([CH]=O)[N+])}}
 +
{{#set: inchi key=InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O}}
 +
{{#set: common name=histidinal}}
 +
{{#set: molecular weight=140.164    }}
 +
{{#set: common name=L-histidinal}}
 +
{{#set: consumed by=HISTALDEHYD-RXN}}
 +
{{#set: consumed or produced by=HISTOLDEHYD-RXN}}

Revision as of 11:00, 18 January 2018

Metabolite HISTIDINAL

  • smiles:
    • C1(NC=NC=1CC([CH]=O)[N+])
  • inchi key:
    • InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O
  • common name:
    • histidinal
  • molecular weight:
    • 140.164
  • Synonym(s):
    • L-histidinal

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(NC=NC=1CC([CH]=O)[N+])" cannot be used as a page name in this wiki.