Difference between revisions of "CYCLOARTENOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5)))) | ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5)))) | ||
| + | * molecular weight: | ||
| + | ** 426.724 | ||
* inchi key: | * inchi key: | ||
** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N | ** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N | ||
* common name: | * common name: | ||
** cycloartenol | ** cycloartenol | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** 9β,19-cyclo-24-lanosten-3β-ol | ** 9β,19-cyclo-24-lanosten-3β-ol | ||
| Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[extended_1.14.13.72-RXN_CYCLOARTENOL]] | ||
| + | * [[extended_RXN66-28_CYCLOARTENOL]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[CYCLOARTENOL-SYNTHASE-RXN]] | * [[CYCLOARTENOL-SYNTHASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030] | ||
* CAS : 469-38-5 | * CAS : 469-38-5 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254] | ||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902] | ** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902] | ||
* HMDB : HMDB36591 | * HMDB : HMDB36591 | ||
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}} | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}} | ||
| + | {{#set: molecular weight=426.724 }} | ||
{{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}} | {{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}} | ||
{{#set: common name=cycloartenol}} | {{#set: common name=cycloartenol}} | ||
| − | |||
{{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}} | {{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}} | ||
| + | {{#set: consumed by=extended_1.14.13.72-RXN_CYCLOARTENOL|extended_RXN66-28_CYCLOARTENOL}} | ||
{{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}} | {{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}} | ||
Latest revision as of 16:15, 9 January 2019
Contents
Metabolite CYCLOARTENOL
- smiles:
- CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
- molecular weight:
- 426.724
- inchi key:
- InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
- common name:
- cycloartenol
- Synonym(s):
- 9β,19-cyclo-24-lanosten-3β-ol
- cycloart-24(25)-enol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.
