Difference between revisions of "PYRIDOXAL-4-DEHYDROGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00009270001 == * left end position: ** 189450 * transcription direction: ** POSITIVE * right end position: ** 190634 * centisome position: ** 79...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9903 CPD-9903] == * smiles: ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene CHC_T00009270001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9903 CPD-9903] ==
−
* left end position:
+
* smiles:
−
** 189450
+
** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=LIEYLSGXGOXYTD-CTBYCIIYSA-M
−
* right end position:
+
* common name:
−
** 190634
+
** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate
−
* centisome position:
+
* molecular weight:
−
** 79.108574    
+
** 629.941    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
 +
** 3-heptaprenyl-4,5-dihydroxybenzoate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
+
* [[RXN-9287]]
−
** original_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=189450}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740353 54740353]
−
{{#set: right end position=190634}}
+
* CHEBI:
−
{{#set: centisome position=79.108574   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84450 84450]
−
{{#set: reaction associated=HISTONE-ACETYLTRANSFERASE-RXN}}
+
{{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C}}
 +
{{#set: inchi key=InChIKey=LIEYLSGXGOXYTD-CTBYCIIYSA-M}}
 +
{{#set: common name=3,4-dihydroxy-5-all-trans-heptaprenylbenzoate}}
 +
{{#set: molecular weight=629.941   }}
 +
{{#set: common name=3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid|3-heptaprenyl-4,5-dihydroxybenzoate}}
 +
{{#set: consumed by=RXN-9287}}

Revision as of 12:00, 18 January 2018

Metabolite CPD-9903

  • smiles:
    • CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C
  • inchi key:
    • InChIKey=LIEYLSGXGOXYTD-CTBYCIIYSA-M
  • common name:
    • 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate
  • molecular weight:
    • 629.941
  • Synonym(s):
    • 3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
    • 3-heptaprenyl-4,5-dihydroxybenzoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PYRIDOXAL-4-DEHYDROGENASE-RXN&oldid=5902"