Difference between revisions of "CPD-14646"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14646 CPD-14646] == * smiles: ** CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(=C(CCCC2(C)C)C))C)C | ** CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(=C(CCCC2(C)C)C))C)C | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 536.882 | ** 536.882 | ||
+ | * inchi key: | ||
+ | ** InChIKey=OENHQHLEOONYIE-BVZAMQQESA-N | ||
+ | * common name: | ||
+ | ** 9-cis-β-carotene | ||
* Synonym(s): | * Synonym(s): | ||
Line 16: | Line 16: | ||
* [[RXN-13641]] | * [[RXN-13641]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67188 67188] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67188 67188] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9828626 9828626] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9828626 9828626] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C20484 C20484] | ||
{{#set: smiles=CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(=C(CCCC2(C)C)C))C)C}} | {{#set: smiles=CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(=C(CCCC2(C)C)C))C)C}} | ||
− | |||
− | |||
{{#set: molecular weight=536.882 }} | {{#set: molecular weight=536.882 }} | ||
+ | {{#set: inchi key=InChIKey=OENHQHLEOONYIE-BVZAMQQESA-N}} | ||
+ | {{#set: common name=9-cis-β-carotene}} | ||
{{#set: reversible reaction associated=RXN-13641}} | {{#set: reversible reaction associated=RXN-13641}} |
Latest revision as of 16:20, 9 January 2019
Contents
Metabolite CPD-14646
- smiles:
- CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(=C(CCCC2(C)C)C))C)C
- molecular weight:
- 536.882
- inchi key:
- InChIKey=OENHQHLEOONYIE-BVZAMQQESA-N
- common name:
- 9-cis-β-carotene
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links