Difference between revisions of "PWY-3341"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * inchi key: ** InChIKey=LEHOTFFKMJEO...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATESYNTH-RXN DIHYDROFOLATESYNTH-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [ht...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATESYNTH-RXN DIHYDROFOLATESYNTH-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/6.3.2.12 EC-6.3.2.12] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[7-8-DIHYDROPTEROATE]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[GLT]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[DIHYDROFOLATE]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[PROTON]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 7,8-dihydropteroate[c] '''+''' 1 ATP[c] '''+''' 1 L-glutamate[c] '''=>''' 1 ADP[c] '''+''' 1 7,8-dihydrofolate monoglutamate[c] '''+''' 1 phosphate[c] '''+''' 1 H+[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[CHC_T00000400001_1]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6614]], tetrahydrofolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6614 PWY-6614] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[galdieria.sulphuraria]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23584 23584] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02237 R02237] | |
− | + | * UNIPROT: | |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q9JVC6 Q9JVC6] |
− | + | ** [http://www.uniprot.org/uniprot/P43775 P43775] | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/Q9PNK6 Q9PNK6] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/Q50990 Q50990] |
− | * | + | ** [http://www.uniprot.org/uniprot/P08192 P08192] |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | * | + | {{#set: ec number=EC-6.3.2.12}} |
− | + | {{#set: gene associated=CHC_T00000400001_1}} | |
− | {{#set: | + | {{#set: in pathway=PWY-6614}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | {{#set: reconstruction source=galdieria.sulphuraria}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 12:00, 18 January 2018
Contents
Reaction DIHYDROFOLATESYNTH-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 7-8-DIHYDROPTEROATE[c] + 1 ATP[c] + 1 GLT[c] => 1 ADP[c] + 1 DIHYDROFOLATE[c] + 1 Pi[c] + 1 PROTON[c]
- With common name(s):
- 1 7,8-dihydropteroate[c] + 1 ATP[c] + 1 L-glutamate[c] => 1 ADP[c] + 1 7,8-dihydrofolate monoglutamate[c] + 1 phosphate[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-6614, tetrahydrofolate biosynthesis: PWY-6614
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
External links