Difference between revisions of "LEU"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] == * smiles: ** CC(CC([N+])C([O-])=O)C * inchi key: ** InChIKey=ROHFNLRQFUQHCH-YFKPBYR...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(CC([N+])C([O-])=O)C | ** CC(CC([N+])C([O-])=O)C | ||
| + | * molecular weight: | ||
| + | ** 131.174 | ||
* inchi key: | * inchi key: | ||
** InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N | ** InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N | ||
* common name: | * common name: | ||
** L-leucine | ** L-leucine | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** (2S)-α-2-amino-4-methylvaleric acid | ** (2S)-α-2-amino-4-methylvaleric acid | ||
| Line 23: | Line 23: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]] | ||
* [[LEUCINE-23-AMINOMUTASE-RXN]] | * [[LEUCINE-23-AMINOMUTASE-RXN]] | ||
| − | |||
== External links == | == External links == | ||
| − | * | + | * METABOLIGHTS : MTBLC57427 |
| − | * | + | * BIGG : leu__L |
* CAS : 61-90-5 | * CAS : 61-90-5 | ||
| − | |||
| − | |||
| − | |||
* HMDB : HMDB00687 | * HMDB : HMDB00687 | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57427 57427] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57427 57427] | ||
| − | * | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00123 C00123] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7045798 7045798] | ||
| + | * NCI: | ||
| + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=46709 46709] | ||
{{#set: smiles=CC(CC([N+])C([O-])=O)C}} | {{#set: smiles=CC(CC([N+])C([O-])=O)C}} | ||
| + | {{#set: molecular weight=131.174 }} | ||
{{#set: inchi key=InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N}} | {{#set: inchi key=InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N}} | ||
{{#set: common name=L-leucine}} | {{#set: common name=L-leucine}} | ||
| − | |||
{{#set: common name=(2S)-α-2-amino-4-methylvaleric acid|L|leu|leucine|2-amino-4-methylvaleric acid|(2S)-α-leucine|L-leu}} | {{#set: common name=(2S)-α-2-amino-4-methylvaleric acid|L|leu|leucine|2-amino-4-methylvaleric acid|(2S)-α-leucine|L-leu}} | ||
{{#set: consumed by=LEUCINE--TRNA-LIGASE-RXN|biomass_rxn}} | {{#set: consumed by=LEUCINE--TRNA-LIGASE-RXN|biomass_rxn}} | ||
| − | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=BRANCHED-CHAINAMINOTRANSFERLEU-RXN|LEUCINE-23-AMINOMUTASE-RXN}} |
Latest revision as of 16:32, 9 January 2019
Contents
Metabolite LEU
- smiles:
- CC(CC([N+])C([O-])=O)C
- molecular weight:
- 131.174
- inchi key:
- InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N
- common name:
- L-leucine
- Synonym(s):
- (2S)-α-2-amino-4-methylvaleric acid
- L
- leu
- leucine
- 2-amino-4-methylvaleric acid
- (2S)-α-leucine
- L-leu
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC57427
- BIGG : leu__L
- CAS : 61-90-5
- HMDB : HMDB00687
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
- NCI:
"CC(CC([N+])C([O-])=O)C" cannot be used as a page name in this wiki.
