Difference between revisions of "PWY66-378"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == * smiles: ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] * common name: ** L-cys...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7826 PWY-7826] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4668 TAX-46...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7826 PWY-7826] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4668 TAX-4668] |
* common name: | * common name: | ||
− | ** | + | ** Amaryllidacea alkaloids biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | * '''1''' reaction(s) found |
− | + | ** [[RXN-8872]] | |
− | * [[ | + | == Reaction(s) not found == |
+ | * '''24''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18126 RXN-18126] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18138 RXN-18138] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18153 RXN-18153] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18152 RXN-18152] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18137 RXN-18137] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18136 RXN-18136] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18135 RXN-18135] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18134 RXN-18134] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18133 RXN-18133] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18132 RXN-18132] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TYROSINE-DECARBOXYLASE-RXN TYROSINE-DECARBOXYLASE-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18127 RXN-18127] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18120 RXN-18120] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18121 RXN-18121] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18122 RXN-18122] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18123 RXN-18123] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18142 RXN-18142] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18125 RXN-18125] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18140 RXN-18140] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18141 RXN-18141] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18128 RXN-18128] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18129 RXN-18129] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8871 RXN-8871] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18124 RXN-18124] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4668}} | |
− | + | {{#set: common name=Amaryllidacea alkaloids biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=24}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 11:01, 18 January 2018
Pathway PWY-7826
- taxonomic range:
- common name:
- Amaryllidacea alkaloids biosynthesis
- Synonym(s):
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 24 reaction(s) not found