Difference between revisions of "CPD0-1699"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1699 CPD0-1699] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2)) * common name: ** 6...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2)) | ** C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 210.172 | ** 210.172 | ||
| + | * inchi key: | ||
| + | ** InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M | ||
| + | * common name: | ||
| + | ** 6-carboxy-5,6,7,8-tetrahydropterin | ||
* Synonym(s): | * Synonym(s): | ||
** 6-carboxytetrahydropterin | ** 6-carboxytetrahydropterin | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61032 61032] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61032 61032] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123380 44123380] | ||
{{#set: smiles=C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))}} | {{#set: smiles=C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=210.172 }} | {{#set: molecular weight=210.172 }} | ||
| + | {{#set: inchi key=InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=6-carboxy-5,6,7,8-tetrahydropterin}} | ||
{{#set: common name=6-carboxytetrahydropterin}} | {{#set: common name=6-carboxytetrahydropterin}} | ||
{{#set: produced by=RXN0-5507}} | {{#set: produced by=RXN0-5507}} | ||
Latest revision as of 16:52, 9 January 2019
Contents
Metabolite CPD0-1699
- smiles:
- C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))
- molecular weight:
- 210.172
- inchi key:
- InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M
- common name:
- 6-carboxy-5,6,7,8-tetrahydropterin
- Synonym(s):
- 6-carboxytetrahydropterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))" cannot be used as a page name in this wiki.
