Difference between revisions of "CPD-8610"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C | ||
+ | * molecular weight: | ||
+ | ** 414.713 | ||
* inchi key: | * inchi key: | ||
** InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N | ** InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N | ||
* common name: | * common name: | ||
** 4,4-dimethyl-5α-cholesta-8-en-3-β-ol | ** 4,4-dimethyl-5α-cholesta-8-en-3-β-ol | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
* [[RXN66-15]] | * [[RXN66-15]] | ||
+ | * [[RXN-13711]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN66-14]] | * [[RXN66-14]] | ||
Line 20: | Line 20: | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12070223 12070223] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12070223 12070223] | ||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C15915 C15915] | ** [http://www.genome.jp/dbget-bin/www_bget?C15915 C15915] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.10474091.html 10474091] | ||
* HMDB : HMDB06840 | * HMDB : HMDB06840 | ||
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}} | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}} | ||
+ | {{#set: molecular weight=414.713 }} | ||
{{#set: inchi key=InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N}} | {{#set: inchi key=InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N}} | ||
{{#set: common name=4,4-dimethyl-5α-cholesta-8-en-3-β-ol}} | {{#set: common name=4,4-dimethyl-5α-cholesta-8-en-3-β-ol}} | ||
− | + | {{#set: consumed by=RXN66-15|RXN-13711}} | |
− | {{#set: consumed by=RXN-13711 | + | |
{{#set: produced by=RXN66-14}} | {{#set: produced by=RXN66-14}} |
Latest revision as of 17:59, 9 January 2019
Contents
Metabolite CPD-8610
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
- molecular weight:
- 414.713
- inchi key:
- InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N
- common name:
- 4,4-dimethyl-5α-cholesta-8-en-3-β-ol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.