Difference between revisions of "RXN-10954"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17641 CPD-17641] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCCCO)COP(=O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17641 CPD-17641] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=WMNWNRKMANJLHY-LFZQUHGESA-J |
* common name: | * common name: | ||
| − | ** | + | ** 18-hydroxystearoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1045.968 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ω-hydroxy-octadecanoyl-coenzyme A |
| − | ** | + | ** ω-hydroxystearoyl-CoA |
| + | ** 18-hydroxy-octadecanoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-16401]] | |
| − | + | ||
| − | * [[RXN- | + | |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819832 91819832] |
| − | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
| − | + | {{#set: inchi key=InChIKey=WMNWNRKMANJLHY-LFZQUHGESA-J}} | |
| − | + | {{#set: common name=18-hydroxystearoyl-CoA}} | |
| − | + | {{#set: molecular weight=1045.968 }} | |
| − | + | {{#set: common name=ω-hydroxy-octadecanoyl-coenzyme A|ω-hydroxystearoyl-CoA|18-hydroxy-octadecanoyl-CoA}} | |
| − | + | {{#set: produced by=RXN-16401}} | |
| − | {{#set: smiles=C( | + | |
| − | {{#set: inchi key=InChIKey= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: produced by= | + | |
Revision as of 12:02, 18 January 2018
Contents
Metabolite CPD-17641
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=WMNWNRKMANJLHY-LFZQUHGESA-J
- common name:
- 18-hydroxystearoyl-CoA
- molecular weight:
- 1045.968
- Synonym(s):
- ω-hydroxy-octadecanoyl-coenzyme A
- ω-hydroxystearoyl-CoA
- 18-hydroxy-octadecanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
