Difference between revisions of "CPD-18238"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18238 CPD-18238] == * smiles: ** C(=O)([O-])OP([O-])(=O)O * inchi key: ** InChIKey=LQQCGEGR...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)([O-])OP([O-])(=O)O | ** C(=O)([O-])OP([O-])(=O)O | ||
+ | * molecular weight: | ||
+ | ** 139.989 | ||
* inchi key: | * inchi key: | ||
** InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L | ** InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
** carboxyphosphate | ** carboxyphosphate | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86994 86994] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826591 91826591] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826591 91826591] | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.169776.html 169776] | ** [http://www.chemspider.com/Chemical-Structure.169776.html 169776] | ||
− | |||
− | |||
{{#set: smiles=C(=O)([O-])OP([O-])(=O)O}} | {{#set: smiles=C(=O)([O-])OP([O-])(=O)O}} | ||
+ | {{#set: molecular weight=139.989 }} | ||
{{#set: inchi key=InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L}} | {{#set: inchi key=InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L}} | ||
{{#set: common name=carboxyphosphate}} | {{#set: common name=carboxyphosphate}} | ||
− | |||
{{#set: consumed by=RXN-16910}} | {{#set: consumed by=RXN-16910}} | ||
{{#set: produced by=RXN-16909}} | {{#set: produced by=RXN-16909}} |
Latest revision as of 17:13, 9 January 2019
Contents
Metabolite CPD-18238
- smiles:
- C(=O)([O-])OP([O-])(=O)O
- molecular weight:
- 139.989
- inchi key:
- InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L
- common name:
- carboxyphosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])OP([O-])(=O)O" cannot be used as a page name in this wiki.