Difference between revisions of "CPD-13576"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * smiles: ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) * inchi key: *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) | ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) | ||
| + | * molecular weight: | ||
| + | ** 264.169 | ||
* inchi key: | * inchi key: | ||
** InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K | ** InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K | ||
* common name: | * common name: | ||
** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate | ** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** cThz-P | ** cThz-P | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62890 62890] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62890 62890] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477624 53477624] | ||
{{#set: smiles=CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)}} | {{#set: smiles=CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)}} | ||
| + | {{#set: molecular weight=264.169 }} | ||
{{#set: inchi key=InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K}} | {{#set: inchi key=InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K}} | ||
{{#set: common name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}} | {{#set: common name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}} | ||
| − | |||
{{#set: common name=cThz-P}} | {{#set: common name=cThz-P}} | ||
{{#set: consumed by=RXN-12610}} | {{#set: consumed by=RXN-12610}} | ||
Latest revision as of 17:17, 9 January 2019
Contents
Metabolite CPD-13576
- smiles:
- CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)
- molecular weight:
- 264.169
- inchi key:
- InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K
- common name:
- 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
- Synonym(s):
- cThz-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)" cannot be used as a page name in this wiki.
