Difference between revisions of "CPD-356"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-356 CPD-356] == * smiles: ** C(O)C1(OC(=O)C(O)C(O)1) * inchi key: ** InChIKey=CUOKHACJLGPRH...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C1(OC(=O)C(O)C(O)1) | ** C(O)C1(OC(=O)C(O)C(O)1) | ||
| + | * molecular weight: | ||
| + | ** 148.115 | ||
* inchi key: | * inchi key: | ||
** InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N | ** InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N | ||
* common name: | * common name: | ||
** D-arabinono-1,4-lactone | ** D-arabinono-1,4-lactone | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16292 16292] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16292 16292] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=17723 17723] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C00652 C00652] | ** [http://www.genome.jp/dbget-bin/www_bget?C00652 C00652] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.16751.html 16751] | ||
{{#set: smiles=C(O)C1(OC(=O)C(O)C(O)1)}} | {{#set: smiles=C(O)C1(OC(=O)C(O)C(O)1)}} | ||
| + | {{#set: molecular weight=148.115 }} | ||
{{#set: inchi key=InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N}} | {{#set: inchi key=InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N}} | ||
{{#set: common name=D-arabinono-1,4-lactone}} | {{#set: common name=D-arabinono-1,4-lactone}} | ||
| − | |||
{{#set: consumed by=1.1.3.37-RXN}} | {{#set: consumed by=1.1.3.37-RXN}} | ||
Latest revision as of 17:21, 9 January 2019
Contents
Metabolite CPD-356
- smiles:
- C(O)C1(OC(=O)C(O)C(O)1)
- molecular weight:
- 148.115
- inchi key:
- InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N
- common name:
- D-arabinono-1,4-lactone
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
