Difference between revisions of "RXN-10711"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10600 CPD-10600] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C=CC(O)=CC=1))COP...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14195 RXN-14195] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10600 CPD-10600] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14195 RXN-14195] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=OVQOJJJXNYHOPR-FUEUKBNZSA-J
+
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
−
* common name:
+
−
** 4-hydroxybenzoyl-acetyl-CoA
+
−
* molecular weight:
+
−
** 925.647   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-(4-hydroxyphenyl)-3-oxo-propanoyl-CoA
 
−
** 3-(4-hydroxyphenyl)-3-keto-propanoyl-CoA
 
−
** 3-(4-hydroxyphenyl)-3-keto-propionyl-CoA
 
−
** 3-(4-hydroxyphenyl)-3-oxo-propionyl-CoA
 
−
** p-hydroxybenzoyl-acetyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11246]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 2 [[WATER]][c] '''+''' 1 [[DATP]][c] '''=>''' 1 [[DAMP]][c] '''+''' 2 [[Pi]][c] '''+''' 2 [[PROTON]][c]
−
* [[RXN-11245]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 2 H2O[c] '''+''' 1 dATP[c] '''=>''' 1 dAMP[c] '''+''' 2 phosphate[c] '''+''' 2 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00001236001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200630 25200630]
+
{{#set: ec number=EC-3.6.1.5}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: gene associated=CHC_T00001236001_1}}
−
{{#set: inchi key=InChIKey=OVQOJJJXNYHOPR-FUEUKBNZSA-J}}
+
{{#set: in pathway=}}
−
{{#set: common name=4-hydroxybenzoyl-acetyl-CoA}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=925.647    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=3-(4-hydroxyphenyl)-3-oxo-propanoyl-CoA|3-(4-hydroxyphenyl)-3-keto-propanoyl-CoA|3-(4-hydroxyphenyl)-3-keto-propionyl-CoA|3-(4-hydroxyphenyl)-3-oxo-propionyl-CoA|p-hydroxybenzoyl-acetyl-CoA}}
+
{{#set: reconstruction source=galdieria.sulphuraria}}
−
{{#set: consumed by=RXN-11246}}
+
−
{{#set: produced by=RXN-11245}}
+

Revision as of 11:03, 18 January 2018

Reaction RXN-14195

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2 H2O[c] + 1 dATP[c] => 1 dAMP[c] + 2 phosphate[c] + 2 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-10711&oldid=6171"