Difference between revisions of "CPD-11671"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) * inchi key: ** InChIKey=KQR...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) | ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) | ||
| + | * molecular weight: | ||
| + | ** 177.202 | ||
* inchi key: | * inchi key: | ||
** InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N | ** InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
** 5-hydroxytryptophol | ** 5-hydroxytryptophol | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** hydroxytryptophol | ** hydroxytryptophol | ||
| Line 27: | Line 27: | ||
* HMDB : HMDB01855 | * HMDB : HMDB01855 | ||
{{#set: smiles=C(O)CC1(=CNC2(=C1C=C(O)C=C2))}} | {{#set: smiles=C(O)CC1(=CNC2(=C1C=C(O)C=C2))}} | ||
| + | {{#set: molecular weight=177.202 }} | ||
{{#set: inchi key=InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N}} | {{#set: inchi key=InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N}} | ||
{{#set: common name=5-hydroxytryptophol}} | {{#set: common name=5-hydroxytryptophol}} | ||
| − | |||
{{#set: common name=hydroxytryptophol|5-hydroxyindole-3-ethanol|5-hydroxy-1H-indole-3-ethanol|1H-indole-3-ethanol, 5-hydroxy-|indole-3-ethanol, 5-hydroxy-}} | {{#set: common name=hydroxytryptophol|5-hydroxyindole-3-ethanol|5-hydroxy-1H-indole-3-ethanol|1H-indole-3-ethanol, 5-hydroxy-|indole-3-ethanol, 5-hydroxy-}} | ||
{{#set: produced by=RXN-10781}} | {{#set: produced by=RXN-10781}} | ||
Latest revision as of 17:30, 9 January 2019
Contents
Metabolite CPD-11671
- smiles:
- C(O)CC1(=CNC2(=C1C=C(O)C=C2))
- molecular weight:
- 177.202
- inchi key:
- InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N
- common name:
- 5-hydroxytryptophol
- Synonym(s):
- hydroxytryptophol
- 5-hydroxyindole-3-ethanol
- 5-hydroxy-1H-indole-3-ethanol
- 1H-indole-3-ethanol, 5-hydroxy-
- indole-3-ethanol, 5-hydroxy-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
