Difference between revisions of "MG+2"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Deoxyhypusine-Synthase-Lysine Deoxyhypusine-Synthase-Lysine] == * common name: ** a [deoxyhypus...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Deoxyhypusine-Synthase-Lysine Deoxyhypusine-Synthase-Lysine] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a [deoxyhypusine synthase]-L-lysine |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-13415]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-13416]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a [deoxyhypusine synthase]-L-lysine}} | |
− | + | {{#set: consumed by=RXN-13415}} | |
− | + | {{#set: produced by=RXN-13416}} | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 11:03, 18 January 2018
Contents
Metabolite Deoxyhypusine-Synthase-Lysine
- common name:
- a [deoxyhypusine synthase]-L-lysine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [deoxyhypusine synthase]-L-lysine" cannot be used as a page name in this wiki.