Difference between revisions of "RXN-1827"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O) * inchi k...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=SO4ASSIM-PWY SO4ASSIM-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-475...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=SO4ASSIM-PWY SO4ASSIM-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** ( | + | ** sulfate reduction I (assimilatory) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | * '''2''' reaction(s) found | |
− | * [[RXN- | + | ** [[SULFITE-REDUCT-RXN]] |
− | == Reaction(s) | + | ** [[PWY-5340]] |
+ | == Reaction(s) not found == | ||
+ | * '''1''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=1.8.4.8-RXN 1.8.4.8-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=SO4ASSIM-PWY SO4ASSIM-PWY] |
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=sulfate reduction I (assimilatory)}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: reaction not found=1}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name=( | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 10:47, 18 January 2018
Pathway SO4ASSIM-PWY
Reaction(s) found
- 2 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found
External links
- ECOCYC: